C20H24N4O3 — CID 108834975
ethyl 4-[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108834975) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is ethyl 4-[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108834975 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | ethyl 4-[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C=C(/C#N)C(=O)N2CCCc3ccccc32)CC1 |
| InChI | InChI=1S/C20H24N4O3/c1-2-27-20(26)23-12-10-22(11-13-23)15-17(14-21)19(25)24-9-5-7-16-6-3-4-8-18(16)24/h3-4,6,8,15H,2,5,7,9-13H2,1H3/b17-15- |
| InChIKey | KJLQMCYLURBMJU-ICFOKQHNSA-N |
| XLogP | 2.15 |
| TPSA | 76.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|