C25H26N4O3 — CID 108834974
(Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile (PubChem CID 108834974) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108834974 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/N1CCN(Cc2ccc3c(c2)OCO3)CC1)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C25H26N4O3/c26-15-21(25(30)29-9-3-5-20-4-1-2-6-22(20)29)17-28-12-10-27(11-13-28)16-19-7-8-23-24(14-19)32-18-31-23/h1-2,4,6-8,14,17H,3,5,9-13,16,18H2/b21-17- |
| InChIKey | KJBNSFRJYUKDPQ-FXBPSFAMSA-N |
| XLogP | 2.92 |
| TPSA | 69.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|