C22H27N5O4 — CID 108841289
(Z)-2-(4-acetylpiperazine-1-carbonyl)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]prop-2-enenitrile (PubChem CID 108841289) has the molecular formula C22H27N5O4 and a molecular weight of 425.49 g/mol. Its IUPAC name is (Z)-2-(4-acetylpiperazine-1-carbonyl)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-acetylpiperazine-1-carbonyl)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 108841289 |
| Molecular Formula | C22H27N5O4 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (Z)-2-(4-acetylpiperazine-1-carbonyl)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]prop-2-enenitrile |
| SMILES | CC(=O)N1CCN(C(=O)/C(C#N)=C\N2CCN(Cc3ccc4c(c3)OCO4)CC2)CC1 |
| InChI | InChI=1S/C22H27N5O4/c1-17(28)26-8-10-27(11-9-26)22(29)19(13-23)15-25-6-4-24(5-7-25)14-18-2-3-20-21(12-18)31-16-30-20/h2-3,12,15H,4-11,14,16H2,1H3/b19-15- |
| InChIKey | BGIXAUSGBSIGTB-CYVLTUHYSA-N |
| XLogP | 0.63 |
| TPSA | 89.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|