C26H30N4O3 — CID 108822699
(Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide (PubChem CID 108822699) has the molecular formula C26H30N4O3 and a molecular weight of 446.55 g/mol. Its IUPAC name is (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108822699 |
| Molecular Formula | C26H30N4O3 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | (Z)-3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-2-cyano-N-(2-methyl-6-propan-2-ylphenyl)prop-2-enamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)/C(C#N)=C\N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C26H30N4O3/c1-18(2)22-6-4-5-19(3)25(22)28-26(31)21(14-27)16-30-11-9-29(10-12-30)15-20-7-8-23-24(13-20)33-17-32-23/h4-8,13,16,18H,9-12,15,17H2,1-3H3,(H,28,31)/b21-16- |
| InChIKey | XMSRHNWJPIQOEI-PGMHBOJBSA-N |
| XLogP | 4.01 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|