C21H21N3O — CID 108834827
(Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(4-ethylanilino)prop-2-enenitrile (PubChem CID 108834827) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(4-ethylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(4-ethylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108834827 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(4-ethylanilino)prop-2-enenitrile |
| SMILES | CCc1ccc(N/C=C(/C#N)C(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H21N3O/c1-2-16-9-11-19(12-10-16)23-15-18(14-22)21(25)24-13-5-7-17-6-3-4-8-20(17)24/h3-4,6,8-12,15,23H,2,5,7,13H2,1H3/b18-15- |
| InChIKey | VJBGJHRCARNSKD-SDXDJHTJSA-N |
| XLogP | 4.05 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|