C19H16FN3O — CID 108834813
(Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(2-fluoroanilino)prop-2-enenitrile (PubChem CID 108834813) has the molecular formula C19H16FN3O and a molecular weight of 321.36 g/mol. Its IUPAC name is (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(2-fluoroanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(2-fluoroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108834813 |
| Molecular Formula | C19H16FN3O |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(2-fluoroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1ccccc1F)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H16FN3O/c20-16-8-2-3-9-17(16)22-13-15(12-21)19(24)23-11-5-7-14-6-1-4-10-18(14)23/h1-4,6,8-10,13,22H,5,7,11H2/b15-13- |
| InChIKey | NTAZIUDEXFBKGB-SQFISAMPSA-N |
| XLogP | 3.62 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|