C20H18ClN3O — CID 108834755
(Z)-3-(5-chloro-2-methylanilino)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile (PubChem CID 108834755) has the molecular formula C20H18ClN3O and a molecular weight of 351.84 g/mol. Its IUPAC name is (Z)-3-(5-chloro-2-methylanilino)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(5-chloro-2-methylanilino)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108834755 |
| Molecular Formula | C20H18ClN3O |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | (Z)-3-(5-chloro-2-methylanilino)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1ccc(Cl)cc1N/C=C(/C#N)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H18ClN3O/c1-14-8-9-17(21)11-18(14)23-13-16(12-22)20(25)24-10-4-6-15-5-2-3-7-19(15)24/h2-3,5,7-9,11,13,23H,4,6,10H2,1H3/b16-13- |
| InChIKey | WORKRISVBOERPZ-SSZFMOIBSA-N |
| XLogP | 4.45 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|