C20H19N3O — CID 108834678
(Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(2-methylanilino)prop-2-enenitrile (PubChem CID 108834678) has the molecular formula C20H19N3O and a molecular weight of 317.39 g/mol. Its IUPAC name is (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(2-methylanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(2-methylanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108834678 |
| Molecular Formula | C20H19N3O |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (Z)-2-(3,4-dihydro-2H-quinoline-1-carbonyl)-3-(2-methylanilino)prop-2-enenitrile |
| SMILES | Cc1ccccc1N/C=C(/C#N)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H19N3O/c1-15-7-2-4-10-18(15)22-14-17(13-21)20(24)23-12-6-9-16-8-3-5-11-19(16)23/h2-5,7-8,10-11,14,22H,6,9,12H2,1H3/b17-14- |
| InChIKey | GMLDCQBWAKHKMH-VKAVYKQESA-N |
| XLogP | 3.79 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|