C19H18N4O3S — CID 108834733
4-[[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide (PubChem CID 108834733) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 4-[[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide.
| Compound Name | 4-[[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 108834733 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
| SMILES | N#C/C(=C/Nc1ccc(S(N)(=O)=O)cc1)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H18N4O3S/c20-12-15(13-22-16-7-9-17(10-8-16)27(21,25)26)19(24)23-11-3-5-14-4-1-2-6-18(14)23/h1-2,4,6-10,13,22H,3,5,11H2,(H2,21,25,26)/b15-13- |
| InChIKey | HHOFSCRMWVOGOS-SQFISAMPSA-N |
| XLogP | 2.13 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|