C20H20N4O3S — CID 108834809
4-[[[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]amino]methyl]benzenesulfonamide (PubChem CID 108834809) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 4-[[[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]amino]methyl]benzenesulfonamide.
| Compound Name | 4-[[[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]amino]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 108834809 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 4-[[[(Z)-2-cyano-3-(3,4-dihydro-2H-quinolin-1-yl)-3-oxoprop-1-enyl]amino]methyl]benzenesulfonamide |
| SMILES | N#C/C(=C/NCc1ccc(S(N)(=O)=O)cc1)C(=O)N1CCCc2ccccc21 |
| InChI | InChI=1S/C20H20N4O3S/c21-12-17(14-23-13-15-7-9-18(10-8-15)28(22,26)27)20(25)24-11-3-5-16-4-1-2-6-19(16)24/h1-2,4,6-10,14,23H,3,5,11,13H2,(H2,22,26,27)/b17-14- |
| InChIKey | AJAAQAQQMLPXJK-VKAVYKQESA-N |
| XLogP | 1.81 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|