C21H29N3O — CID 108834915
(Z)-3-[bis(2-methylpropyl)amino]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile (PubChem CID 108834915) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is (Z)-3-[bis(2-methylpropyl)amino]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[bis(2-methylpropyl)amino]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108834915 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | (Z)-3-[bis(2-methylpropyl)amino]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile |
| SMILES | CC(C)CN(/C=C(/C#N)C(=O)N1CCCc2ccccc21)CC(C)C |
| InChI | InChI=1S/C21H29N3O/c1-16(2)13-23(14-17(3)4)15-19(12-22)21(25)24-11-7-9-18-8-5-6-10-20(18)24/h5-6,8,10,15-17H,7,9,11,13-14H2,1-4H3/b19-15- |
| InChIKey | AIOAVRBHLDMQAT-CYVLTUHYSA-N |
| XLogP | 3.99 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|