C20H25N3O — CID 108834702
(Z)-3-[cyclohexyl(methyl)amino]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile (PubChem CID 108834702) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (Z)-3-[cyclohexyl(methyl)amino]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[cyclohexyl(methyl)amino]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108834702 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (Z)-3-[cyclohexyl(methyl)amino]-2-(3,4-dihydro-2H-quinoline-1-carbonyl)prop-2-enenitrile |
| SMILES | CN(/C=C(/C#N)C(=O)N1CCCc2ccccc21)C1CCCCC1 |
| InChI | InChI=1S/C20H25N3O/c1-22(18-10-3-2-4-11-18)15-17(14-21)20(24)23-13-7-9-16-8-5-6-12-19(16)23/h5-6,8,12,15,18H,2-4,7,9-11,13H2,1H3/b17-15- |
| InChIKey | KCBRTAYITUEXQW-ICFOKQHNSA-N |
| XLogP | 3.64 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|