C20H17N5O3 — CID 108826797
(Z)-2-cyano-N-(2-cyanophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enamide (PubChem CID 108826797) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2-cyanophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2-cyanophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108826797 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (Z)-2-cyano-N-(2-cyanophenyl)-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enamide |
| SMILES | N#C/C(=C/N1CCN(C(=O)c2ccco2)CC1)C(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C20H17N5O3/c21-12-15-4-1-2-5-17(15)23-19(26)16(13-22)14-24-7-9-25(10-8-24)20(27)18-6-3-11-28-18/h1-6,11,14H,7-10H2,(H,23,26)/b16-14- |
| InChIKey | YSDNPHRRJULSPK-PEZBUJJGSA-N |
| XLogP | 1.96 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|