C16H18N4O5 — CID 108844975
2-[[(Z)-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enoyl]amino]propanoic acid (PubChem CID 108844975) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 2-[[(Z)-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enoyl]amino]propanoic acid.
| Compound Name | 2-[[(Z)-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 108844975 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 2-[[(Z)-2-cyano-3-[4-(furan-2-carbonyl)piperazin-1-yl]prop-2-enoyl]amino]propanoic acid |
| SMILES | CC(NC(=O)/C(C#N)=C\N1CCN(C(=O)c2ccco2)CC1)C(=O)O |
| InChI | InChI=1S/C16H18N4O5/c1-11(16(23)24)18-14(21)12(9-17)10-19-4-6-20(7-5-19)15(22)13-3-2-8-25-13/h2-3,8,10-11H,4-7H2,1H3,(H,18,21)(H,23,24)/b12-10- |
| InChIKey | KOILWTNSFZXWPY-BENRWUELSA-N |
| XLogP | 0.03 |
| TPSA | 126.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|