C22H24N4O4 — CID 108843076
ethyl 4-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate (PubChem CID 108843076) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is ethyl 4-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108843076 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | ethyl 4-[[(Z)-2-cyano-3-[(5-hydroxynaphthalen-1-yl)amino]-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C=C(/C#N)C(=O)Nc2cccc3c(O)cccc23)CC1 |
| InChI | InChI=1S/C22H24N4O4/c1-2-30-22(29)26-11-9-16(10-12-26)24-14-15(13-23)21(28)25-19-7-3-6-18-17(19)5-4-8-20(18)27/h3-8,14,16,24,27H,2,9-12H2,1H3,(H,25,28)/b15-14- |
| InChIKey | BUPHOVKWVKSXBY-PFONDFGASA-N |
| XLogP | 3.10 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|