C26H30N4O3S — CID 108857335
tert-butyl 4-[[(Z)-2-cyano-3-oxo-3-(2-phenylsulfanylanilino)prop-1-enyl]amino]piperidine-1-carboxylate (PubChem CID 108857335) has the molecular formula C26H30N4O3S and a molecular weight of 478.62 g/mol. Its IUPAC name is tert-butyl 4-[[(Z)-2-cyano-3-oxo-3-(2-phenylsulfanylanilino)prop-1-enyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(Z)-2-cyano-3-oxo-3-(2-phenylsulfanylanilino)prop-1-enyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108857335 |
| Molecular Formula | C26H30N4O3S |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | tert-butyl 4-[[(Z)-2-cyano-3-oxo-3-(2-phenylsulfanylanilino)prop-1-enyl]amino]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(N/C=C(/C#N)C(=O)Nc2ccccc2Sc2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N4O3S/c1-26(2,3)33-25(32)30-15-13-20(14-16-30)28-18-19(17-27)24(31)29-22-11-7-8-12-23(22)34-21-9-5-4-6-10-21/h4-12,18,20,28H,13-16H2,1-3H3,(H,29,31)/b19-18- |
| InChIKey | NOGJLCXRQARMEC-HNENSFHCSA-N |
| XLogP | 5.17 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|