C21H27N5O6 — CID 108852859
tert-butyl 4-[[(Z)-2-cyano-3-(2-methoxy-4-nitroanilino)-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate (PubChem CID 108852859) has the molecular formula C21H27N5O6 and a molecular weight of 445.48 g/mol. Its IUPAC name is tert-butyl 4-[[(Z)-2-cyano-3-(2-methoxy-4-nitroanilino)-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[(Z)-2-cyano-3-(2-methoxy-4-nitroanilino)-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108852859 |
| Molecular Formula | C21H27N5O6 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | tert-butyl 4-[[(Z)-2-cyano-3-(2-methoxy-4-nitroanilino)-3-oxoprop-1-enyl]amino]piperidine-1-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)/C(C#N)=C\NC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C21H27N5O6/c1-21(2,3)32-20(28)25-9-7-15(8-10-25)23-13-14(12-22)19(27)24-17-6-5-16(26(29)30)11-18(17)31-4/h5-6,11,13,15,23H,7-10H2,1-4H3,(H,24,27)/b14-13- |
| InChIKey | UXGPNWSUDDJIBY-YPKPFQOOSA-N |
| XLogP | 2.94 |
| TPSA | 146.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|