C33H37N5O — CID 108832740
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(1-benzylpiperidin-4-yl)amino]prop-2-enenitrile (PubChem CID 108832740) has the molecular formula C33H37N5O and a molecular weight of 519.69 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(1-benzylpiperidin-4-yl)amino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(1-benzylpiperidin-4-yl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108832740 |
| Molecular Formula | C33H37N5O |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[(1-benzylpiperidin-4-yl)amino]prop-2-enenitrile |
| SMILES | N#C/C(=C/NC1CCN(Cc2ccccc2)CC1)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C33H37N5O/c34-24-30(25-35-31-16-18-36(19-17-31)26-27-10-4-1-5-11-27)33(39)38-22-20-37(21-23-38)32(28-12-6-2-7-13-28)29-14-8-3-9-15-29/h1-15,25,31-32,35H,16-23,26H2/b30-25- |
| InChIKey | CIPAFEVMYOTCEC-JVCXMKTPSA-N |
| XLogP | 4.58 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|