C31H36N4O — CID 108832696
(Z)-3-(1-adamantylamino)-2-(4-benzhydrylpiperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 108832696) has the molecular formula C31H36N4O and a molecular weight of 480.66 g/mol. Its IUPAC name is (Z)-3-(1-adamantylamino)-2-(4-benzhydrylpiperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(1-adamantylamino)-2-(4-benzhydrylpiperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108832696 |
| Molecular Formula | C31H36N4O |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (Z)-3-(1-adamantylamino)-2-(4-benzhydrylpiperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | N#C/C(=C/NC12CC3CC(CC(C3)C1)C2)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C31H36N4O/c32-21-28(22-33-31-18-23-15-24(19-31)17-25(16-23)20-31)30(36)35-13-11-34(12-14-35)29(26-7-3-1-4-8-26)27-9-5-2-6-10-27/h1-10,22-25,29,33H,11-20H2/b28-22- |
| InChIKey | GUOXOAGIQDNSNA-SLMZUGIISA-N |
| XLogP | 4.89 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|