C29H24F6N4O — CID 108832676
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[3,5-bis(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 108832676) has the molecular formula C29H24F6N4O and a molecular weight of 558.53 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[3,5-bis(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[3,5-bis(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108832676 |
| Molecular Formula | C29H24F6N4O |
| Molecular Weight | 558.53 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-[3,5-bis(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H24F6N4O/c30-28(31,32)23-15-24(29(33,34)35)17-25(16-23)37-19-22(18-36)27(40)39-13-11-38(12-14-39)26(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-10,15-17,19,26,37H,11-14H2/b22-19- |
| InChIKey | XPENUKCNGJOJOY-QOCHGBHMSA-N |
| XLogP | 6.48 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.53 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|