C16H16F3N3O — CID 108862166
(Z)-2-(piperidine-1-carbonyl)-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile (PubChem CID 108862166) has the molecular formula C16H16F3N3O and a molecular weight of 323.32 g/mol. Its IUPAC name is (Z)-2-(piperidine-1-carbonyl)-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile.
| Compound Name | (Z)-2-(piperidine-1-carbonyl)-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile |
|---|---|
| PubChem CID | 108862166 |
| Molecular Formula | C16H16F3N3O |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | (Z)-2-(piperidine-1-carbonyl)-3-[3-(trifluoromethyl)anilino]prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1cccc(C(F)(F)F)c1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C16H16F3N3O/c17-16(18,19)13-5-4-6-14(9-13)21-11-12(10-20)15(23)22-7-2-1-3-8-22/h4-6,9,11,21H,1-3,7-8H2/b12-11- |
| InChIKey | TZZAGPGLBKNGDY-QXMHVHEDSA-N |
| XLogP | 3.54 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|