C27H24Cl2N4O — CID 108832462
(Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(2,5-dichloroanilino)prop-2-enenitrile (PubChem CID 108832462) has the molecular formula C27H24Cl2N4O and a molecular weight of 491.42 g/mol. Its IUPAC name is (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(2,5-dichloroanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(2,5-dichloroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108832462 |
| Molecular Formula | C27H24Cl2N4O |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (Z)-2-(4-benzhydrylpiperazine-1-carbonyl)-3-(2,5-dichloroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1cc(Cl)ccc1Cl)C(=O)N1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H24Cl2N4O/c28-23-11-12-24(29)25(17-23)31-19-22(18-30)27(34)33-15-13-32(14-16-33)26(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-12,17,19,26,31H,13-16H2/b22-19- |
| InChIKey | HLQCNQFXCBWNHZ-QOCHGBHMSA-N |
| XLogP | 5.75 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|