C22H31ClN4O2 — CID 108830867
(Z)-2-(2,6-dimethylmorpholine-4-carbonyl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enenitrile;hydrochloride (PubChem CID 108830867) has the molecular formula C22H31ClN4O2 and a molecular weight of 418.97 g/mol. Its IUPAC name is (Z)-2-(2,6-dimethylmorpholine-4-carbonyl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enenitrile;hydrochloride.
| Compound Name | (Z)-2-(2,6-dimethylmorpholine-4-carbonyl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enenitrile;hydrochloride |
|---|---|
| PubChem CID | 108830867 |
| Molecular Formula | C22H31ClN4O2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | (Z)-2-(2,6-dimethylmorpholine-4-carbonyl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]prop-2-enenitrile;hydrochloride |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)N3CC(C)OC(C)C3)CC2)c1C.Cl |
| InChI | InChI=1S/C22H30N4O2.ClH/c1-16-6-5-7-21(19(16)4)25-10-8-24(9-11-25)15-20(12-23)22(27)26-13-17(2)28-18(3)14-26;/h5-7,15,17-18H,8-11,13-14H2,1-4H3;1H/b20-15-; |
| InChIKey | PDWZYCPCDYFPQJ-CRDKNBMZSA-N |
| XLogP | 2.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|