C20H28N4O3 — CID 108844582
(Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N,N-bis(2-hydroxyethyl)prop-2-enamide (PubChem CID 108844582) has the molecular formula C20H28N4O3 and a molecular weight of 372.47 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N,N-bis(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N,N-bis(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108844582 |
| Molecular Formula | C20H28N4O3 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | (Z)-2-cyano-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N,N-bis(2-hydroxyethyl)prop-2-enamide |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)N(CCO)CCO)CC2)c1C |
| InChI | InChI=1S/C20H28N4O3/c1-16-4-3-5-19(17(16)2)23-8-6-22(7-9-23)15-18(14-21)20(27)24(10-12-25)11-13-26/h3-5,15,25-26H,6-13H2,1-2H3/b18-15- |
| InChIKey | BDMBCUXFXAMTCI-SDXDJHTJSA-N |
| XLogP | 0.65 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|