C20H27N5O — CID 108820067
(Z)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-(piperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 108820067) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is (Z)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-(piperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-(piperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108820067 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (Z)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2-(piperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cccc(N2CCN(/C=C(/C#N)C(=O)N3CCNCC3)CC2)c1C |
| InChI | InChI=1S/C20H27N5O/c1-16-4-3-5-19(17(16)2)24-12-10-23(11-13-24)15-18(14-21)20(26)25-8-6-22-7-9-25/h3-5,15,22H,6-13H2,1-2H3/b18-15- |
| InChIKey | RXONFTUPFPDMGT-SDXDJHTJSA-N |
| XLogP | 1.26 |
| TPSA | 62.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|