C21H32N4O2 — CID 108507340
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-methyl-N-(1-methylpiperidin-4-yl)-2-oxoacetamide (PubChem CID 108507340) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-methyl-N-(1-methylpiperidin-4-yl)-2-oxoacetamide.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-methyl-N-(1-methylpiperidin-4-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108507340 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-N-methyl-N-(1-methylpiperidin-4-yl)-2-oxoacetamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C(=O)N(C)C3CCN(C)CC3)CC2)c1C |
| InChI | InChI=1S/C21H32N4O2/c1-16-6-5-7-19(17(16)2)24-12-14-25(15-13-24)21(27)20(26)23(4)18-8-10-22(3)11-9-18/h5-7,18H,8-15H2,1-4H3 |
| InChIKey | JQICJPGFUSANRY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|