C23H35N3O2 — CID 108965457
1-(azepan-1-yl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2,2-dimethylpropane-1,3-dione (PubChem CID 108965457) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2,2-dimethylpropane-1,3-dione.
| Compound Name | 1-(azepan-1-yl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2,2-dimethylpropane-1,3-dione |
|---|---|
| PubChem CID | 108965457 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 1-(azepan-1-yl)-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]-2,2-dimethylpropane-1,3-dione |
| SMILES | Cc1cccc(N2CCN(C(=O)C(C)(C)C(=O)N3CCCCCC3)CC2)c1C |
| InChI | InChI=1S/C23H35N3O2/c1-18-10-9-11-20(19(18)2)24-14-16-26(17-15-24)22(28)23(3,4)21(27)25-12-7-5-6-8-13-25/h9-11H,5-8,12-17H2,1-4H3 |
| InChIKey | PTIYBLXEMPLTAS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|