C23H33N3O2 — CID 108978812
azepan-1-yl-[1-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]cyclopropyl]methanone (PubChem CID 108978812) has the molecular formula C23H33N3O2 and a molecular weight of 383.54 g/mol. Its IUPAC name is azepan-1-yl-[1-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]cyclopropyl]methanone.
| Compound Name | azepan-1-yl-[1-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]cyclopropyl]methanone |
|---|---|
| PubChem CID | 108978812 |
| Molecular Formula | C23H33N3O2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.26 |
| IUPAC Name | azepan-1-yl-[1-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]cyclopropyl]methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)C3(C(=O)N4CCCCCC4)CC3)CC2)c1C |
| InChI | InChI=1S/C23H33N3O2/c1-18-8-7-9-20(19(18)2)24-14-16-26(17-15-24)22(28)23(10-11-23)21(27)25-12-5-3-4-6-13-25/h7-9H,3-6,10-17H2,1-2H3 |
| InChIKey | XILRENOJXVMOSM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|