C23H28N2O — CID 110436569
[4-(2,3-dimethylphenyl)piperazin-1-yl]-(1-phenylcyclobutyl)methanone (PubChem CID 110436569) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is [4-(2,3-dimethylphenyl)piperazin-1-yl]-(1-phenylcyclobutyl)methanone.
| Compound Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-(1-phenylcyclobutyl)methanone |
|---|---|
| PubChem CID | 110436569 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | [4-(2,3-dimethylphenyl)piperazin-1-yl]-(1-phenylcyclobutyl)methanone |
| SMILES | Cc1cccc(N2CCN(C(=O)C3(c4ccccc4)CCC3)CC2)c1C |
| InChI | InChI=1S/C23H28N2O/c1-18-8-6-11-21(19(18)2)24-14-16-25(17-15-24)22(26)23(12-7-13-23)20-9-4-3-5-10-20/h3-6,8-11H,7,12-17H2,1-2H3 |
| InChIKey | UUYGCAXRQUYJGW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |