C22H26N2O — CID 4048114
(1-phenylcyclopentyl)-(4-phenylpiperazin-1-yl)methanone (PubChem CID 4048114) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (1-phenylcyclopentyl)-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | (1-phenylcyclopentyl)-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 4048114 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (1-phenylcyclopentyl)-(4-phenylpiperazin-1-yl)methanone |
| SMILES | O=C(N1CCN(c2ccccc2)CC1)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C22H26N2O/c25-21(22(13-7-8-14-22)19-9-3-1-4-10-19)24-17-15-23(16-18-24)20-11-5-2-6-12-20/h1-6,9-12H,7-8,13-18H2 |
| InChIKey | VLGZONOVPLJAJM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |