C20H24N2OS — CID 42390617
(4-phenylpiperazin-1-yl)-(1-thiophen-2-ylcyclopentyl)methanone (PubChem CID 42390617) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is (4-phenylpiperazin-1-yl)-(1-thiophen-2-ylcyclopentyl)methanone.
| Compound Name | (4-phenylpiperazin-1-yl)-(1-thiophen-2-ylcyclopentyl)methanone |
|---|---|
| PubChem CID | 42390617 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (4-phenylpiperazin-1-yl)-(1-thiophen-2-ylcyclopentyl)methanone |
| SMILES | O=C(N1CCN(c2ccccc2)CC1)C1(c2cccs2)CCCC1 |
| InChI | InChI=1S/C20H24N2OS/c23-19(20(10-4-5-11-20)18-9-6-16-24-18)22-14-12-21(13-15-22)17-7-2-1-3-8-17/h1-3,6-9,16H,4-5,10-15H2 |
| InChIKey | KFLKNIRQMYLMLR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |