C16H23NOS — CID 42435504
(4-methylpiperidin-1-yl)-(1-thiophen-2-ylcyclopentyl)methanone (PubChem CID 42435504) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is (4-methylpiperidin-1-yl)-(1-thiophen-2-ylcyclopentyl)methanone.
| Compound Name | (4-methylpiperidin-1-yl)-(1-thiophen-2-ylcyclopentyl)methanone |
|---|---|
| PubChem CID | 42435504 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | (4-methylpiperidin-1-yl)-(1-thiophen-2-ylcyclopentyl)methanone |
| SMILES | CC1CCN(C(=O)C2(c3cccs3)CCCC2)CC1 |
| InChI | InChI=1S/C16H23NOS/c1-13-6-10-17(11-7-13)15(18)16(8-2-3-9-16)14-5-4-12-19-14/h4-5,12-13H,2-3,6-11H2,1H3 |
| InChIKey | ZILOOWLNTDOFOT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |