C18H25NO3S — CID 42435336
ethyl 1-(1-thiophen-2-ylcyclopentanecarbonyl)piperidine-4-carboxylate (PubChem CID 42435336) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is ethyl 1-(1-thiophen-2-ylcyclopentanecarbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(1-thiophen-2-ylcyclopentanecarbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42435336 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | ethyl 1-(1-thiophen-2-ylcyclopentanecarbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2(c3cccs3)CCCC2)CC1 |
| InChI | InChI=1S/C18H25NO3S/c1-2-22-16(20)14-7-11-19(12-8-14)17(21)18(9-3-4-10-18)15-6-5-13-23-15/h5-6,13-14H,2-4,7-12H2,1H3 |
| InChIKey | NNBMFNZVRNPGBE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |