C19H28N2O — CID 135165735
(1-phenylcyclopentyl)-(4-propan-2-ylpiperazin-1-yl)methanone (PubChem CID 135165735) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is (1-phenylcyclopentyl)-(4-propan-2-ylpiperazin-1-yl)methanone.
| Compound Name | (1-phenylcyclopentyl)-(4-propan-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 135165735 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | (1-phenylcyclopentyl)-(4-propan-2-ylpiperazin-1-yl)methanone |
| SMILES | CC(C)N1CCN(C(=O)C2(c3ccccc3)CCCC2)CC1 |
| InChI | InChI=1S/C19H28N2O/c1-16(2)20-12-14-21(15-13-20)18(22)19(10-6-7-11-19)17-8-4-3-5-9-17/h3-5,8-9,16H,6-7,10-15H2,1-2H3 |
| InChIKey | YYEKNZIJMFIWQE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |