C15H20N2O — CID 110463899
(1-phenylcyclobutyl)-piperazin-1-ylmethanone (PubChem CID 110463899) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (1-phenylcyclobutyl)-piperazin-1-ylmethanone.
| Compound Name | (1-phenylcyclobutyl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 110463899 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (1-phenylcyclobutyl)-piperazin-1-ylmethanone |
| SMILES | O=C(N1CCNCC1)C1(c2ccccc2)CCC1 |
| InChI | InChI=1S/C15H20N2O/c18-14(17-11-9-16-10-12-17)15(7-4-8-15)13-5-2-1-3-6-13/h1-3,5-6,16H,4,7-12H2 |
| InChIKey | CKZDWKIFIQXOHB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |