C29H37N3O2 — CID 22241011
cyclohexyl-[4-phenyl-4-(4-phenylpiperazine-1-carbonyl)piperidin-1-yl]methanone (PubChem CID 22241011) has the molecular formula C29H37N3O2 and a molecular weight of 459.63 g/mol. Its IUPAC name is cyclohexyl-[4-phenyl-4-(4-phenylpiperazine-1-carbonyl)piperidin-1-yl]methanone.
| Compound Name | cyclohexyl-[4-phenyl-4-(4-phenylpiperazine-1-carbonyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 22241011 |
| Molecular Formula | C29H37N3O2 |
| Molecular Weight | 459.63 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | cyclohexyl-[4-phenyl-4-(4-phenylpiperazine-1-carbonyl)piperidin-1-yl]methanone |
| SMILES | O=C(C1CCCCC1)N1CCC(C(=O)N2CCN(c3ccccc3)CC2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H37N3O2/c33-27(24-10-4-1-5-11-24)31-18-16-29(17-19-31,25-12-6-2-7-13-25)28(34)32-22-20-30(21-23-32)26-14-8-3-9-15-26/h2-3,6-9,12-15,24H,1,4-5,10-11,16-23H2 |
| InChIKey | LFVIJRPDASFUJY-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.63 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |