C23H26FN3O2 — CID 108978820
1-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-N-(3-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 108978820) has the molecular formula C23H26FN3O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-N-(3-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | 1-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-N-(3-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 108978820 |
| Molecular Formula | C23H26FN3O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1-[4-(2,3-dimethylphenyl)piperazine-1-carbonyl]-N-(3-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)C3(C(=O)Nc4cccc(F)c4)CC3)CC2)c1C |
| InChI | InChI=1S/C23H26FN3O2/c1-16-5-3-8-20(17(16)2)26-11-13-27(14-12-26)22(29)23(9-10-23)21(28)25-19-7-4-6-18(24)15-19/h3-8,15H,9-14H2,1-2H3,(H,25,28) |
| InChIKey | DBSXQOVWPMNUMY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|