C16H19ClN4 — CID 155942484
5-chloro-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidine (PubChem CID 155942484) has the molecular formula C16H19ClN4 and a molecular weight of 302.81 g/mol. Its IUPAC name is 5-chloro-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 155942484 |
| Molecular Formula | C16H19ClN4 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-chloro-2-[4-(2,3-dimethylphenyl)piperazin-1-yl]pyrimidine |
| SMILES | Cc1cccc(N2CCN(c3ncc(Cl)cn3)CC2)c1C |
| InChI | InChI=1S/C16H19ClN4/c1-12-4-3-5-15(13(12)2)20-6-8-21(9-7-20)16-18-10-14(17)11-19-16/h3-5,10-11H,6-9H2,1-2H3 |
| InChIKey | DGDNQVKGGDMLPO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |