C14H21ClN2 — CID 61286908
1-(2-chloroethyl)-4-(2,3-dimethylphenyl)piperazine (PubChem CID 61286908) has the molecular formula C14H21ClN2 and a molecular weight of 252.79 g/mol. Its IUPAC name is 1-(2-chloroethyl)-4-(2,3-dimethylphenyl)piperazine.
| Compound Name | 1-(2-chloroethyl)-4-(2,3-dimethylphenyl)piperazine |
|---|---|
| PubChem CID | 61286908 |
| Molecular Formula | C14H21ClN2 |
| Molecular Weight | 252.79 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-(2-chloroethyl)-4-(2,3-dimethylphenyl)piperazine |
| SMILES | Cc1cccc(N2CCN(CCCl)CC2)c1C |
| InChI | InChI=1S/C14H21ClN2/c1-12-4-3-5-14(13(12)2)17-10-8-16(7-6-15)9-11-17/h3-5H,6-11H2,1-2H3 |
| InChIKey | GMNZUHCOJJDAKZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|