2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid

C16H25N3O2 — CID 63028507

IUPAC2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid
SMILESCc1cccc(N2CCN(CCC(N)C(=O)O)CC2)c1C
InChIInChI=1S/C16H25N3O2/c1-12-4-3-5-15(13(12)2)19-10-8-18(9-11-19)7-6-14(17)16(20)21/h3-5,14H,6-11,17H2,1-2H3,(H,20,21)
InChIKeyZBUVEOZUYOHWPU-UHFFFAOYSA-N
MW291.40 g/mol
LogP1.23
Rot. Bonds5

About 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid

2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid (PubChem CID 63028507) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid.

Molecular Properties

Compound Name2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid
PubChem CID63028507
Molecular FormulaC16H25N3O2
Molecular Weight291.40 g/mol
Exact Mass291.19
IUPAC Name2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid
SMILESCc1cccc(N2CCN(CCC(N)C(=O)O)CC2)c1C
InChIInChI=1S/C16H25N3O2/c1-12-4-3-5-15(13(12)2)19-10-8-18(9-11-19)7-6-14(17)16(20)21/h3-5,14H,6-11,17H2,1-2H3,(H,20,21)
InChIKeyZBUVEOZUYOHWPU-UHFFFAOYSA-N
XLogP1.23
TPSA69.80 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500291.40
LogP ≤ 51.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid?
The IUPAC name of 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid (CID 63028507) is 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid.
What is the SMILES notation for 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid?
The canonical SMILES for 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid is Cc1cccc(N2CCN(CCC(N)C(=O)O)CC2)c1C.
What is the InChIKey of 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid?
The InChIKey is ZBUVEOZUYOHWPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-12-4-3-5-15(13(12)2)19-10-8-18(9-11-19)7-6-14(17)16(20)21/h3-5,14H,6-11,17H2,1-2H3,(H,20,21).
What are the key properties of 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid?
2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid has a molecular weight of 291.40 g/mol, XLogP of 1.23, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid is sourced from PubChem (CID 63028507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).