C16H25N3O2 — CID 63028507
2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid (PubChem CID 63028507) has the molecular formula C16H25N3O2 and a molecular weight of 291.40 g/mol. Its IUPAC name is 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid.
| Compound Name | 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 63028507 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-amino-4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanoic acid |
| SMILES | Cc1cccc(N2CCN(CCC(N)C(=O)O)CC2)c1C |
| InChI | InChI=1S/C16H25N3O2/c1-12-4-3-5-15(13(12)2)19-10-8-18(9-11-19)7-6-14(17)16(20)21/h3-5,14H,6-11,17H2,1-2H3,(H,20,21) |
| InChIKey | ZBUVEOZUYOHWPU-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |