C16H23BrN2O2 — CID 81091395
methyl 2-bromo-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propanoate (PubChem CID 81091395) has the molecular formula C16H23BrN2O2 and a molecular weight of 355.28 g/mol. Its IUPAC name is methyl 2-bromo-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propanoate.
| Compound Name | methyl 2-bromo-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 81091395 |
| Molecular Formula | C16H23BrN2O2 |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | methyl 2-bromo-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propanoate |
| SMILES | COC(=O)C(Br)CN1CCN(c2cccc(C)c2C)CC1 |
| InChI | InChI=1S/C16H23BrN2O2/c1-12-5-4-6-15(13(12)2)19-9-7-18(8-10-19)11-14(17)16(20)21-3/h4-6,14H,7-11H2,1-3H3 |
| InChIKey | IKOHDVXZDMHZEP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|