C15H21BrN2O2 — CID 81100689
methyl 2-bromo-3-[4-(3-methylphenyl)piperazin-1-yl]propanoate (PubChem CID 81100689) has the molecular formula C15H21BrN2O2 and a molecular weight of 341.25 g/mol. Its IUPAC name is methyl 2-bromo-3-[4-(3-methylphenyl)piperazin-1-yl]propanoate.
| Compound Name | methyl 2-bromo-3-[4-(3-methylphenyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 81100689 |
| Molecular Formula | C15H21BrN2O2 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | methyl 2-bromo-3-[4-(3-methylphenyl)piperazin-1-yl]propanoate |
| SMILES | COC(=O)C(Br)CN1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C15H21BrN2O2/c1-12-4-3-5-13(10-12)18-8-6-17(7-9-18)11-14(16)15(19)20-2/h3-5,10,14H,6-9,11H2,1-2H3 |
| InChIKey | HTIZHCCLOZMNFK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|