C14H22Cl2N2O2 — CID 43810604
3-[4-(3-methylphenyl)piperazin-1-yl]propanoic acid;dihydrochloride (PubChem CID 43810604) has the molecular formula C14H22Cl2N2O2 and a molecular weight of 321.25 g/mol. Its IUPAC name is 3-[4-(3-methylphenyl)piperazin-1-yl]propanoic acid;dihydrochloride.
| Compound Name | 3-[4-(3-methylphenyl)piperazin-1-yl]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 43810604 |
| Molecular Formula | C14H22Cl2N2O2 |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 3-[4-(3-methylphenyl)piperazin-1-yl]propanoic acid;dihydrochloride |
| SMILES | Cc1cccc(N2CCN(CCC(=O)O)CC2)c1.Cl.Cl |
| InChI | InChI=1S/C14H20N2O2.2ClH/c1-12-3-2-4-13(11-12)16-9-7-15(8-10-16)6-5-14(17)18;;/h2-4,11H,5-10H2,1H3,(H,17,18);2*1H |
| InChIKey | IFZYNXNZXSKQEE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |