C17H25N3O3 — CID 119943282
(2S)-2-[3-[4-(3-methylphenyl)piperazin-1-yl]propanoylamino]propanoic acid (PubChem CID 119943282) has the molecular formula C17H25N3O3 and a molecular weight of 319.41 g/mol. Its IUPAC name is (2S)-2-[3-[4-(3-methylphenyl)piperazin-1-yl]propanoylamino]propanoic acid.
| Compound Name | (2S)-2-[3-[4-(3-methylphenyl)piperazin-1-yl]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119943282 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | (2S)-2-[3-[4-(3-methylphenyl)piperazin-1-yl]propanoylamino]propanoic acid |
| SMILES | Cc1cccc(N2CCN(CCC(=O)N[C@@H](C)C(=O)O)CC2)c1 |
| InChI | InChI=1S/C17H25N3O3/c1-13-4-3-5-15(12-13)20-10-8-19(9-11-20)7-6-16(21)18-14(2)17(22)23/h3-5,12,14H,6-11H2,1-2H3,(H,18,21)(H,22,23)/t14-/m0/s1 |
| InChIKey | NSSIUFYOHOOEOB-AWEZNQCLSA-N |
| XLogP | 1.10 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |