C20H34N4O — CID 119667631
N-(1-aminohexan-2-yl)-3-[4-(3-methylphenyl)piperazin-1-yl]propanamide (PubChem CID 119667631) has the molecular formula C20H34N4O and a molecular weight of 346.52 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-[4-(3-methylphenyl)piperazin-1-yl]propanamide.
| Compound Name | N-(1-aminohexan-2-yl)-3-[4-(3-methylphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 119667631 |
| Molecular Formula | C20H34N4O |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-[4-(3-methylphenyl)piperazin-1-yl]propanamide |
| SMILES | CCCCC(CN)NC(=O)CCN1CCN(c2cccc(C)c2)CC1 |
| InChI | InChI=1S/C20H34N4O/c1-3-4-7-18(16-21)22-20(25)9-10-23-11-13-24(14-12-23)19-8-5-6-17(2)15-19/h5-6,8,15,18H,3-4,7,9-14,16,21H2,1-2H3,(H,22,25) |
| InChIKey | UGMBLQSTIMFRIE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |