C18H33Cl2N5O — CID 119665105
N-(1-aminohexan-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propanamide;dihydrochloride (PubChem CID 119665105) has the molecular formula C18H33Cl2N5O and a molecular weight of 406.40 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propanamide;dihydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119665105 |
| Molecular Formula | C18H33Cl2N5O |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-(1-aminohexan-2-yl)-3-(4-pyridin-2-ylpiperazin-1-yl)propanamide;dihydrochloride |
| SMILES | CCCCC(CN)NC(=O)CCN1CCN(c2ccccn2)CC1.Cl.Cl |
| InChI | InChI=1S/C18H31N5O.2ClH/c1-2-3-6-16(15-19)21-18(24)8-10-22-11-13-23(14-12-22)17-7-4-5-9-20-17;;/h4-5,7,9,16H,2-3,6,8,10-15,19H2,1H3,(H,21,24);2*1H |
| InChIKey | OABSNEOSNHSDCQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |