C15H25N3O — CID 43245851
1-amino-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propan-2-ol (PubChem CID 43245851) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 1-amino-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-amino-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 43245851 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 1-amino-3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propan-2-ol |
| SMILES | Cc1cccc(N2CCN(CC(O)CN)CC2)c1C |
| InChI | InChI=1S/C15H25N3O/c1-12-4-3-5-15(13(12)2)18-8-6-17(7-9-18)11-14(19)10-16/h3-5,14,19H,6-11,16H2,1-2H3 |
| InChIKey | UVHXIUWPHSWNJV-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |