C20H25FN2O — CID 110883261
2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-(4-fluorophenyl)ethanol (PubChem CID 110883261) has the molecular formula C20H25FN2O and a molecular weight of 328.43 g/mol. Its IUPAC name is 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-(4-fluorophenyl)ethanol.
| Compound Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 110883261 |
| Molecular Formula | C20H25FN2O |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 2-[4-(2,3-dimethylphenyl)piperazin-1-yl]-1-(4-fluorophenyl)ethanol |
| SMILES | Cc1cccc(N2CCN(CC(O)c3ccc(F)cc3)CC2)c1C |
| InChI | InChI=1S/C20H25FN2O/c1-15-4-3-5-19(16(15)2)23-12-10-22(11-13-23)14-20(24)17-6-8-18(21)9-7-17/h3-9,20,24H,10-14H2,1-2H3 |
| InChIKey | TURKLZYMMDLTDT-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |