C16H23N3 — CID 11107993
4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanenitrile (PubChem CID 11107993) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanenitrile.
| Compound Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 11107993 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 4-[4-(2,3-dimethylphenyl)piperazin-1-yl]butanenitrile |
| SMILES | Cc1cccc(N2CCN(CCCC#N)CC2)c1C |
| InChI | InChI=1S/C16H23N3/c1-14-6-5-7-16(15(14)2)19-12-10-18(11-13-19)9-4-3-8-17/h5-7H,3-4,9-13H2,1-2H3 |
| InChIKey | IUONCOBBCJBURT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|