C21H31Cl2N3S — CID 10224460
4-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propylsulfanyl]aniline;dihydrochloride (PubChem CID 10224460) has the molecular formula C21H31Cl2N3S and a molecular weight of 428.47 g/mol. Its IUPAC name is 4-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propylsulfanyl]aniline;dihydrochloride.
| Compound Name | 4-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propylsulfanyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 10224460 |
| Molecular Formula | C21H31Cl2N3S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 4-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propylsulfanyl]aniline;dihydrochloride |
| SMILES | Cc1cccc(N2CCN(CCCSc3ccc(N)cc3)CC2)c1C.Cl.Cl |
| InChI | InChI=1S/C21H29N3S.2ClH/c1-17-5-3-6-21(18(17)2)24-14-12-23(13-15-24)11-4-16-25-20-9-7-19(22)8-10-20;;/h3,5-10H,4,11-16,22H2,1-2H3;2*1H |
| InChIKey | DICHTQIYMPVTGJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|